C16H24N2O4S — CID 119344769
N-[3-(3,5-dimethoxyphenoxy)propyl]-N-methyl-1,3-thiazolidine-4-carboxamide (PubChem CID 119344769) has the molecular formula C16H24N2O4S and a molecular weight of 340.45 g/mol. Its IUPAC name is N-[3-(3,5-dimethoxyphenoxy)propyl]-N-methyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-[3-(3,5-dimethoxyphenoxy)propyl]-N-methyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 119344769 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N-[3-(3,5-dimethoxyphenoxy)propyl]-N-methyl-1,3-thiazolidine-4-carboxamide |
| SMILES | COc1cc(OC)cc(OCCCN(C)C(=O)C2CSCN2)c1 |
| InChI | InChI=1S/C16H24N2O4S/c1-18(16(19)15-10-23-11-17-15)5-4-6-22-14-8-12(20-2)7-13(9-14)21-3/h7-9,15,17H,4-6,10-11H2,1-3H3 |
| InChIKey | BJAKGVUQGQIEQG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|