C18H28N2O4 — CID 119344771
N-[3-(3,5-dimethoxyphenoxy)propyl]-N-methylpiperidine-2-carboxamide (PubChem CID 119344771) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is N-[3-(3,5-dimethoxyphenoxy)propyl]-N-methylpiperidine-2-carboxamide.
| Compound Name | N-[3-(3,5-dimethoxyphenoxy)propyl]-N-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 119344771 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N-[3-(3,5-dimethoxyphenoxy)propyl]-N-methylpiperidine-2-carboxamide |
| SMILES | COc1cc(OC)cc(OCCCN(C)C(=O)C2CCCCN2)c1 |
| InChI | InChI=1S/C18H28N2O4/c1-20(18(21)17-7-4-5-8-19-17)9-6-10-24-16-12-14(22-2)11-15(13-16)23-3/h11-13,17,19H,4-10H2,1-3H3 |
| InChIKey | LVXXTBYVQZLZQX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|