C17H27ClN2O4 — CID 119820838
N-[3-(3,5-dimethoxyphenoxy)propyl]-N-methylpyrrolidine-3-carboxamide;hydrochloride (PubChem CID 119820838) has the molecular formula C17H27ClN2O4 and a molecular weight of 358.87 g/mol. Its IUPAC name is N-[3-(3,5-dimethoxyphenoxy)propyl]-N-methylpyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | N-[3-(3,5-dimethoxyphenoxy)propyl]-N-methylpyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119820838 |
| Molecular Formula | C17H27ClN2O4 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | N-[3-(3,5-dimethoxyphenoxy)propyl]-N-methylpyrrolidine-3-carboxamide;hydrochloride |
| SMILES | COc1cc(OC)cc(OCCCN(C)C(=O)C2CCNC2)c1.Cl |
| InChI | InChI=1S/C17H26N2O4.ClH/c1-19(17(20)13-5-6-18-12-13)7-4-8-23-16-10-14(21-2)9-15(11-16)22-3;/h9-11,13,18H,4-8,12H2,1-3H3;1H |
| InChIKey | WWVVEXSLSFJTHM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|