C19H30N2O4 — CID 119820809
3-amino-N-[3-(3,5-dimethoxyphenoxy)propyl]-N-methylcyclohexane-1-carboxamide (PubChem CID 119820809) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is 3-amino-N-[3-(3,5-dimethoxyphenoxy)propyl]-N-methylcyclohexane-1-carboxamide.
| Compound Name | 3-amino-N-[3-(3,5-dimethoxyphenoxy)propyl]-N-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119820809 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 3-amino-N-[3-(3,5-dimethoxyphenoxy)propyl]-N-methylcyclohexane-1-carboxamide |
| SMILES | COc1cc(OC)cc(OCCCN(C)C(=O)C2CCCC(N)C2)c1 |
| InChI | InChI=1S/C19H30N2O4/c1-21(19(22)14-6-4-7-15(20)10-14)8-5-9-25-18-12-16(23-2)11-17(13-18)24-3/h11-15H,4-10,20H2,1-3H3 |
| InChIKey | GGVHQQPUMNRLPW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|