C17H25NO3 — CID 91777791
cis-(1S,3R)-3-hydroxy-N-methyl-N-(3-phenoxypropyl)cyclohexane-1-carboxamide (PubChem CID 91777791) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is cis-(1S,3R)-3-hydroxy-N-methyl-N-(3-phenoxypropyl)cyclohexane-1-carboxamide.
| Compound Name | cis-(1S,3R)-3-hydroxy-N-methyl-N-(3-phenoxypropyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 91777791 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | cis-(1S,3R)-3-hydroxy-N-methyl-N-(3-phenoxypropyl)cyclohexane-1-carboxamide |
| SMILES | CN(CCCOc1ccccc1)C(=O)[C@H]1CCC[C@@H](O)C1 |
| InChI | InChI=1S/C17H25NO3/c1-18(17(20)14-7-5-8-15(19)13-14)11-6-12-21-16-9-3-2-4-10-16/h2-4,9-10,14-15,19H,5-8,11-13H2,1H3/t14-,15+/m0/s1 |
| InChIKey | WNUNVZQNTQLRGY-LSDHHAIUSA-N |
| XLogP | 2.46 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|