C17H24N2O3 — CID 94168581
(4S)-N,1-dimethyl-2-oxo-N-(3-phenoxypropyl)piperidine-4-carboxamide (PubChem CID 94168581) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is (4S)-N,1-dimethyl-2-oxo-N-(3-phenoxypropyl)piperidine-4-carboxamide.
| Compound Name | (4S)-N,1-dimethyl-2-oxo-N-(3-phenoxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 94168581 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | (4S)-N,1-dimethyl-2-oxo-N-(3-phenoxypropyl)piperidine-4-carboxamide |
| SMILES | CN1CC[C@H](C(=O)N(C)CCCOc2ccccc2)CC1=O |
| InChI | InChI=1S/C17H24N2O3/c1-18-11-9-14(13-16(18)20)17(21)19(2)10-6-12-22-15-7-4-3-5-8-15/h3-5,7-8,14H,6,9-13H2,1-2H3/t14-/m0/s1 |
| InChIKey | GBDVOTHSYBQORG-AWEZNQCLSA-N |
| XLogP | 1.78 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|