C23H28N2O5 — CID 55654265
1-(2,5-dimethoxyphenyl)-N-methyl-5-oxo-N-(3-phenoxypropyl)pyrrolidine-3-carboxamide (PubChem CID 55654265) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-N-methyl-5-oxo-N-(3-phenoxypropyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(2,5-dimethoxyphenyl)-N-methyl-5-oxo-N-(3-phenoxypropyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55654265 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-N-methyl-5-oxo-N-(3-phenoxypropyl)pyrrolidine-3-carboxamide |
| SMILES | COc1ccc(OC)c(N2CC(C(=O)N(C)CCCOc3ccccc3)CC2=O)c1 |
| InChI | InChI=1S/C23H28N2O5/c1-24(12-7-13-30-18-8-5-4-6-9-18)23(27)17-14-22(26)25(16-17)20-15-19(28-2)10-11-21(20)29-3/h4-6,8-11,15,17H,7,12-14,16H2,1-3H3 |
| InChIKey | CMMULMNRQBSAET-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|