C17H21ClN2O4 — CID 134033372
methyl 4-[[1-(2-chlorophenyl)-5-oxopyrrolidine-3-carbonyl]-methylamino]butanoate (PubChem CID 134033372) has the molecular formula C17H21ClN2O4 and a molecular weight of 352.82 g/mol. Its IUPAC name is methyl 4-[[1-(2-chlorophenyl)-5-oxopyrrolidine-3-carbonyl]-methylamino]butanoate.
| Compound Name | methyl 4-[[1-(2-chlorophenyl)-5-oxopyrrolidine-3-carbonyl]-methylamino]butanoate |
|---|---|
| PubChem CID | 134033372 |
| Molecular Formula | C17H21ClN2O4 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | methyl 4-[[1-(2-chlorophenyl)-5-oxopyrrolidine-3-carbonyl]-methylamino]butanoate |
| SMILES | COC(=O)CCCN(C)C(=O)C1CC(=O)N(c2ccccc2Cl)C1 |
| InChI | InChI=1S/C17H21ClN2O4/c1-19(9-5-8-16(22)24-2)17(23)12-10-15(21)20(11-12)14-7-4-3-6-13(14)18/h3-4,6-7,12H,5,8-11H2,1-2H3 |
| InChIKey | KULCYIAALFVGDW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |