C22H23BrN2O4 — CID 55582309
methyl 3-[benzyl-[1-(2-bromophenyl)-5-oxopyrrolidine-3-carbonyl]amino]propanoate (PubChem CID 55582309) has the molecular formula C22H23BrN2O4 and a molecular weight of 459.34 g/mol. Its IUPAC name is methyl 3-[benzyl-[1-(2-bromophenyl)-5-oxopyrrolidine-3-carbonyl]amino]propanoate.
| Compound Name | methyl 3-[benzyl-[1-(2-bromophenyl)-5-oxopyrrolidine-3-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 55582309 |
| Molecular Formula | C22H23BrN2O4 |
| Molecular Weight | 459.34 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | methyl 3-[benzyl-[1-(2-bromophenyl)-5-oxopyrrolidine-3-carbonyl]amino]propanoate |
| SMILES | COC(=O)CCN(Cc1ccccc1)C(=O)C1CC(=O)N(c2ccccc2Br)C1 |
| InChI | InChI=1S/C22H23BrN2O4/c1-29-21(27)11-12-24(14-16-7-3-2-4-8-16)22(28)17-13-20(26)25(15-17)19-10-6-5-9-18(19)23/h2-10,17H,11-15H2,1H3 |
| InChIKey | FSNLSOOXIPDQRV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |