C23H26N2O4S — CID 55547764
methyl 3-[benzyl-[1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]propanoate (PubChem CID 55547764) has the molecular formula C23H26N2O4S and a molecular weight of 426.54 g/mol. Its IUPAC name is methyl 3-[benzyl-[1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]propanoate.
| Compound Name | methyl 3-[benzyl-[1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 55547764 |
| Molecular Formula | C23H26N2O4S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | methyl 3-[benzyl-[1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]propanoate |
| SMILES | COC(=O)CCN(Cc1ccccc1)C(=O)C1CC(=O)N(c2ccc(SC)cc2)C1 |
| InChI | InChI=1S/C23H26N2O4S/c1-29-22(27)12-13-24(15-17-6-4-3-5-7-17)23(28)18-14-21(26)25(16-18)19-8-10-20(30-2)11-9-19/h3-11,18H,12-16H2,1-2H3 |
| InChIKey | XOVZFQFWHKAPMH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |