C21H24N2O5 — CID 55514579
methyl 3-[benzyl-[1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]propanoate (PubChem CID 55514579) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is methyl 3-[benzyl-[1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]propanoate.
| Compound Name | methyl 3-[benzyl-[1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 55514579 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | methyl 3-[benzyl-[1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]propanoate |
| SMILES | COC(=O)CCN(Cc1ccccc1)C(=O)C1CC(=O)N(Cc2ccco2)C1 |
| InChI | InChI=1S/C21H24N2O5/c1-27-20(25)9-10-22(13-16-6-3-2-4-7-16)21(26)17-12-19(24)23(14-17)15-18-8-5-11-28-18/h2-8,11,17H,9-10,12-15H2,1H3 |
| InChIKey | GDZKFLCZNMFLFG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |