C13H16N2O2 — CID 9350614
(3S)-N,N-dimethyl-5-oxo-1-phenylpyrrolidine-3-carboxamide (PubChem CID 9350614) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is (3S)-N,N-dimethyl-5-oxo-1-phenylpyrrolidine-3-carboxamide.
| Compound Name | (3S)-N,N-dimethyl-5-oxo-1-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 9350614 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | (3S)-N,N-dimethyl-5-oxo-1-phenylpyrrolidine-3-carboxamide |
| SMILES | CN(C)C(=O)[C@H]1CC(=O)N(c2ccccc2)C1 |
| InChI | InChI=1S/C13H16N2O2/c1-14(2)13(17)10-8-12(16)15(9-10)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3/t10-/m0/s1 |
| InChIKey | YTBIQPGPUIGJMQ-JTQLQIEISA-N |
| XLogP | 1.13 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |