C18H18N2O2 — CID 40720221
(3S)-N-methyl-5-oxo-N,1-diphenylpyrrolidine-3-carboxamide (PubChem CID 40720221) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is (3S)-N-methyl-5-oxo-N,1-diphenylpyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-methyl-5-oxo-N,1-diphenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 40720221 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | (3S)-N-methyl-5-oxo-N,1-diphenylpyrrolidine-3-carboxamide |
| SMILES | CN(C(=O)[C@H]1CC(=O)N(c2ccccc2)C1)c1ccccc1 |
| InChI | InChI=1S/C18H18N2O2/c1-19(15-8-4-2-5-9-15)18(22)14-12-17(21)20(13-14)16-10-6-3-7-11-16/h2-11,14H,12-13H2,1H3/t14-/m0/s1 |
| InChIKey | LWOGSLRBMPZTCO-AWEZNQCLSA-N |
| XLogP | 2.70 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |