C18H16ClFN2O2 — CID 17225348
1-(3-chloro-4-fluorophenyl)-N-methyl-5-oxo-N-phenylpyrrolidine-3-carboxamide (PubChem CID 17225348) has the molecular formula C18H16ClFN2O2 and a molecular weight of 346.79 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-N-methyl-5-oxo-N-phenylpyrrolidine-3-carboxamide.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-N-methyl-5-oxo-N-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 17225348 |
| Molecular Formula | C18H16ClFN2O2 |
| Molecular Weight | 346.79 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-N-methyl-5-oxo-N-phenylpyrrolidine-3-carboxamide |
| SMILES | CN(C(=O)C1CC(=O)N(c2ccc(F)c(Cl)c2)C1)c1ccccc1 |
| InChI | InChI=1S/C18H16ClFN2O2/c1-21(13-5-3-2-4-6-13)18(24)12-9-17(23)22(11-12)14-7-8-16(20)15(19)10-14/h2-8,10,12H,9,11H2,1H3 |
| InChIKey | CHQIYCBEHYAPQN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.79 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |