C11H8Cl2FNO2 — CID 50873905
1-(3-chloro-4-fluorophenyl)-5-oxopyrrolidine-3-carbonyl chloride (PubChem CID 50873905) has the molecular formula C11H8Cl2FNO2 and a molecular weight of 276.09 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-5-oxopyrrolidine-3-carbonyl chloride.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-5-oxopyrrolidine-3-carbonyl chloride |
|---|---|
| PubChem CID | 50873905 |
| Molecular Formula | C11H8Cl2FNO2 |
| Molecular Weight | 276.09 g/mol |
| Exact Mass | 274.99 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-5-oxopyrrolidine-3-carbonyl chloride |
| SMILES | O=C(Cl)C1CC(=O)N(c2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C11H8Cl2FNO2/c12-8-4-7(1-2-9(8)14)15-5-6(11(13)17)3-10(15)16/h1-2,4,6H,3,5H2 |
| InChIKey | RSBILLBNJJTBEN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.09 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|