C17H20ClFN2O2 — CID 17225373
1-(3-chloro-4-fluorophenyl)-4-(2-methylpiperidine-1-carbonyl)pyrrolidin-2-one (PubChem CID 17225373) has the molecular formula C17H20ClFN2O2 and a molecular weight of 338.81 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-4-(2-methylpiperidine-1-carbonyl)pyrrolidin-2-one.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-4-(2-methylpiperidine-1-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 17225373 |
| Molecular Formula | C17H20ClFN2O2 |
| Molecular Weight | 338.81 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-4-(2-methylpiperidine-1-carbonyl)pyrrolidin-2-one |
| SMILES | CC1CCCCN1C(=O)C1CC(=O)N(c2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C17H20ClFN2O2/c1-11-4-2-3-7-20(11)17(23)12-8-16(22)21(10-12)13-5-6-15(19)14(18)9-13/h5-6,9,11-12H,2-4,7-8,10H2,1H3 |
| InChIKey | ITENTXAVNBBKCF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.81 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |