C19H26N2O2 — CID 9389079
(4R)-1-(4-ethylphenyl)-4-[(2S)-2-methylpiperidine-1-carbonyl]pyrrolidin-2-one (PubChem CID 9389079) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is (4R)-1-(4-ethylphenyl)-4-[(2S)-2-methylpiperidine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | (4R)-1-(4-ethylphenyl)-4-[(2S)-2-methylpiperidine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 9389079 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | (4R)-1-(4-ethylphenyl)-4-[(2S)-2-methylpiperidine-1-carbonyl]pyrrolidin-2-one |
| SMILES | CCc1ccc(N2C[C@H](C(=O)N3CCCC[C@@H]3C)CC2=O)cc1 |
| InChI | InChI=1S/C19H26N2O2/c1-3-15-7-9-17(10-8-15)21-13-16(12-18(21)22)19(23)20-11-5-4-6-14(20)2/h7-10,14,16H,3-6,11-13H2,1-2H3/t14-,16+/m0/s1 |
| InChIKey | JPQJNPOIVZHTHA-GOEBONIOSA-N |
| XLogP | 3.00 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |