C13H14NO3- — CID 6922046
(3R)-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 6922046) has the molecular formula C13H14NO3- and a molecular weight of 232.26 g/mol. Its IUPAC name is (3R)-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (3R)-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 6922046 |
| Molecular Formula | C13H14NO3- |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | (3R)-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCc1ccc(N2C[C@H](C(=O)[O-])CC2=O)cc1 |
| InChI | InChI=1S/C13H15NO3/c1-2-9-3-5-11(6-4-9)14-8-10(13(16)17)7-12(14)15/h3-6,10H,2,7-8H2,1H3,(H,16,17)/p-1/t10-/m1/s1 |
| InChIKey | DFTUTKZCUVWXKB-SNVBAGLBSA-M |
| XLogP | 0.35 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |