C19H28N2O2 — CID 17081991
1-(4-ethylphenyl)-5-oxo-N,N-dipropylpyrrolidine-3-carboxamide (PubChem CID 17081991) has the molecular formula C19H28N2O2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-5-oxo-N,N-dipropylpyrrolidine-3-carboxamide.
| Compound Name | 1-(4-ethylphenyl)-5-oxo-N,N-dipropylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 17081991 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 1-(4-ethylphenyl)-5-oxo-N,N-dipropylpyrrolidine-3-carboxamide |
| SMILES | CCCN(CCC)C(=O)C1CC(=O)N(c2ccc(CC)cc2)C1 |
| InChI | InChI=1S/C19H28N2O2/c1-4-11-20(12-5-2)19(23)16-13-18(22)21(14-16)17-9-7-15(6-3)8-10-17/h7-10,16H,4-6,11-14H2,1-3H3 |
| InChIKey | ARKDGQVOGNPCIS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |