C15H20N2O2 — CID 9350542
(3S)-N,N-diethyl-5-oxo-1-phenylpyrrolidine-3-carboxamide (PubChem CID 9350542) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is (3S)-N,N-diethyl-5-oxo-1-phenylpyrrolidine-3-carboxamide.
| Compound Name | (3S)-N,N-diethyl-5-oxo-1-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 9350542 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | (3S)-N,N-diethyl-5-oxo-1-phenylpyrrolidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)[C@H]1CC(=O)N(c2ccccc2)C1 |
| InChI | InChI=1S/C15H20N2O2/c1-3-16(4-2)15(19)12-10-14(18)17(11-12)13-8-6-5-7-9-13/h5-9,12H,3-4,10-11H2,1-2H3/t12-/m0/s1 |
| InChIKey | DNSGXZCCMLYYAC-LBPRGKRZSA-N |
| XLogP | 1.91 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |