C17H22N2O3 — CID 9389112
(4R)-1-(4-ethylphenyl)-4-(morpholine-4-carbonyl)pyrrolidin-2-one (PubChem CID 9389112) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is (4R)-1-(4-ethylphenyl)-4-(morpholine-4-carbonyl)pyrrolidin-2-one.
| Compound Name | (4R)-1-(4-ethylphenyl)-4-(morpholine-4-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 9389112 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | (4R)-1-(4-ethylphenyl)-4-(morpholine-4-carbonyl)pyrrolidin-2-one |
| SMILES | CCc1ccc(N2C[C@H](C(=O)N3CCOCC3)CC2=O)cc1 |
| InChI | InChI=1S/C17H22N2O3/c1-2-13-3-5-15(6-4-13)19-12-14(11-16(19)20)17(21)18-7-9-22-10-8-18/h3-6,14H,2,7-12H2,1H3/t14-/m1/s1 |
| InChIKey | FWOQHVJFCCHCPG-CQSZACIVSA-N |
| XLogP | 1.46 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |