C20H24N4O4 — CID 55472622
8-[1-(4-ethylphenyl)-5-oxopyrrolidine-3-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 55472622) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is 8-[1-(4-ethylphenyl)-5-oxopyrrolidine-3-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[1-(4-ethylphenyl)-5-oxopyrrolidine-3-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 55472622 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 8-[1-(4-ethylphenyl)-5-oxopyrrolidine-3-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CCc1ccc(N2CC(C(=O)N3CCC4(CC3)NC(=O)NC4=O)CC2=O)cc1 |
| InChI | InChI=1S/C20H24N4O4/c1-2-13-3-5-15(6-4-13)24-12-14(11-16(24)25)17(26)23-9-7-20(8-10-23)18(27)21-19(28)22-20/h3-6,14H,2,7-12H2,1H3,(H2,21,22,27,28) |
| InChIKey | PHWQHPLGGBEBNO-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|