C13H12NO4- — CID 2376773
(3R)-1-(4-acetylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 2376773) has the molecular formula C13H12NO4- and a molecular weight of 246.24 g/mol. Its IUPAC name is (3R)-1-(4-acetylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (3R)-1-(4-acetylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 2376773 |
| Molecular Formula | C13H12NO4- |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | (3R)-1-(4-acetylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CC(=O)c1ccc(N2C[C@H](C(=O)[O-])CC2=O)cc1 |
| InChI | InChI=1S/C13H13NO4/c1-8(15)9-2-4-11(5-3-9)14-7-10(13(17)18)6-12(14)16/h2-5,10H,6-7H2,1H3,(H,17,18)/p-1/t10-/m1/s1 |
| InChIKey | SQGYWRZISBCKMW-SNVBAGLBSA-M |
| XLogP | -0.01 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |