C11H11ClFN3O2 — CID 125126376
(3S)-1-(3-chloro-4-fluorophenyl)-N'-hydroxy-5-oxopyrrolidine-3-carboximidamide (PubChem CID 125126376) has the molecular formula C11H11ClFN3O2 and a molecular weight of 271.68 g/mol. Its IUPAC name is (3S)-1-(3-chloro-4-fluorophenyl)-N'-hydroxy-5-oxopyrrolidine-3-carboximidamide.
| Compound Name | (3S)-1-(3-chloro-4-fluorophenyl)-N'-hydroxy-5-oxopyrrolidine-3-carboximidamide |
|---|---|
| PubChem CID | 125126376 |
| Molecular Formula | C11H11ClFN3O2 |
| Molecular Weight | 271.68 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | (3S)-1-(3-chloro-4-fluorophenyl)-N'-hydroxy-5-oxopyrrolidine-3-carboximidamide |
| SMILES | N/C(=N/O)[C@H]1CC(=O)N(c2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C11H11ClFN3O2/c12-8-4-7(1-2-9(8)13)16-5-6(3-10(16)17)11(14)15-18/h1-2,4,6,18H,3,5H2,(H2,14,15)/t6-/m0/s1 |
| InChIKey | FRHPDOYCHZULBI-LURJTMIESA-N |
| XLogP | 1.58 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.68 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|