C11H9ClFNO2 — CID 170357825
1-(3-chloro-4-fluorophenyl)-5-oxopyrrolidine-3-carbaldehyde (PubChem CID 170357825) has the molecular formula C11H9ClFNO2 and a molecular weight of 241.65 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-5-oxopyrrolidine-3-carbaldehyde.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-5-oxopyrrolidine-3-carbaldehyde |
|---|---|
| PubChem CID | 170357825 |
| Molecular Formula | C11H9ClFNO2 |
| Molecular Weight | 241.65 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-5-oxopyrrolidine-3-carbaldehyde |
| SMILES | O=CC1CC(=O)N(c2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C11H9ClFNO2/c12-9-4-8(1-2-10(9)13)14-5-7(6-15)3-11(14)16/h1-2,4,6-7H,3,5H2 |
| InChIKey | MIZZKKRLIFBDKQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.65 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|