C13H13ClFNO3 — CID 94075857
ethyl (3R)-1-(3-chloro-4-fluorophenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 94075857) has the molecular formula C13H13ClFNO3 and a molecular weight of 285.70 g/mol. Its IUPAC name is ethyl (3R)-1-(3-chloro-4-fluorophenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-(3-chloro-4-fluorophenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 94075857 |
| Molecular Formula | C13H13ClFNO3 |
| Molecular Weight | 285.70 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | ethyl (3R)-1-(3-chloro-4-fluorophenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC(=O)N(c2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C13H13ClFNO3/c1-2-19-13(18)8-5-12(17)16(7-8)9-3-4-11(15)10(14)6-9/h3-4,6,8H,2,5,7H2,1H3/t8-/m1/s1 |
| InChIKey | XERFWFIPFJHLSK-MRVPVSSYSA-N |
| XLogP | 2.40 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.70 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |