C18H23FN2O3 — CID 50879603
ethyl 1-(3-fluoro-4-piperidin-1-ylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 50879603) has the molecular formula C18H23FN2O3 and a molecular weight of 334.39 g/mol. Its IUPAC name is ethyl 1-(3-fluoro-4-piperidin-1-ylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | ethyl 1-(3-fluoro-4-piperidin-1-ylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 50879603 |
| Molecular Formula | C18H23FN2O3 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | ethyl 1-(3-fluoro-4-piperidin-1-ylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)C1CC(=O)N(c2ccc(N3CCCCC3)c(F)c2)C1 |
| InChI | InChI=1S/C18H23FN2O3/c1-2-24-18(23)13-10-17(22)21(12-13)14-6-7-16(15(19)11-14)20-8-4-3-5-9-20/h6-7,11,13H,2-5,8-10,12H2,1H3 |
| InChIKey | LVSASXUGAIXAJE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|