C17H22N2O3 — CID 94077638
ethyl (3S)-5-oxo-1-(2-pyrrolidin-1-ylphenyl)pyrrolidine-3-carboxylate (PubChem CID 94077638) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is ethyl (3S)-5-oxo-1-(2-pyrrolidin-1-ylphenyl)pyrrolidine-3-carboxylate.
| Compound Name | ethyl (3S)-5-oxo-1-(2-pyrrolidin-1-ylphenyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 94077638 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | ethyl (3S)-5-oxo-1-(2-pyrrolidin-1-ylphenyl)pyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC(=O)N(c2ccccc2N2CCCC2)C1 |
| InChI | InChI=1S/C17H22N2O3/c1-2-22-17(21)13-11-16(20)19(12-13)15-8-4-3-7-14(15)18-9-5-6-10-18/h3-4,7-8,13H,2,5-6,9-12H2,1H3/t13-/m0/s1 |
| InChIKey | CGFUKOJZHDCICW-ZDUSSCGKSA-N |
| XLogP | 2.20 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |