C14H16N2O5 — CID 94076207
ethyl (3S)-1-(2-methyl-3-nitrophenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 94076207) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is ethyl (3S)-1-(2-methyl-3-nitrophenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-(2-methyl-3-nitrophenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 94076207 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | ethyl (3S)-1-(2-methyl-3-nitrophenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC(=O)N(c2cccc([N+](=O)[O-])c2C)C1 |
| InChI | InChI=1S/C14H16N2O5/c1-3-21-14(18)10-7-13(17)15(8-10)11-5-4-6-12(9(11)2)16(19)20/h4-6,10H,3,7-8H2,1-2H3/t10-/m0/s1 |
| InChIKey | NTAZPWNVDSTFNX-JTQLQIEISA-N |
| XLogP | 1.82 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|