C19H18N2O5 — CID 42997291
(4-nitrophenyl) 1-(2,3-dimethylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 42997291) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is (4-nitrophenyl) 1-(2,3-dimethylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (4-nitrophenyl) 1-(2,3-dimethylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 42997291 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | (4-nitrophenyl) 1-(2,3-dimethylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | Cc1cccc(N2CC(C(=O)Oc3ccc([N+](=O)[O-])cc3)CC2=O)c1C |
| InChI | InChI=1S/C19H18N2O5/c1-12-4-3-5-17(13(12)2)20-11-14(10-18(20)22)19(23)26-16-8-6-15(7-9-16)21(24)25/h3-9,14H,10-11H2,1-2H3 |
| InChIKey | OVVURTMBVRYDBM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|