C17H19ClFN3O3 — CID 42655789
1-[1-(3-chloro-4-fluorophenyl)-5-oxopyrrolidine-3-carbonyl]piperidine-4-carboxamide (PubChem CID 42655789) has the molecular formula C17H19ClFN3O3 and a molecular weight of 367.81 g/mol. Its IUPAC name is 1-[1-(3-chloro-4-fluorophenyl)-5-oxopyrrolidine-3-carbonyl]piperidine-4-carboxamide.
| Compound Name | 1-[1-(3-chloro-4-fluorophenyl)-5-oxopyrrolidine-3-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42655789 |
| Molecular Formula | C17H19ClFN3O3 |
| Molecular Weight | 367.81 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 1-[1-(3-chloro-4-fluorophenyl)-5-oxopyrrolidine-3-carbonyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)C2CC(=O)N(c3ccc(F)c(Cl)c3)C2)CC1 |
| InChI | InChI=1S/C17H19ClFN3O3/c18-13-8-12(1-2-14(13)19)22-9-11(7-15(22)23)17(25)21-5-3-10(4-6-21)16(20)24/h1-2,8,10-11H,3-7,9H2,(H2,20,24) |
| InChIKey | UVTUYNBMWXKKBI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.81 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |