C15H20ClFN3O2+ — CID 3469819
2-[[1-(3-chloro-4-fluorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]ethyl-dimethylazanium (PubChem CID 3469819) has the molecular formula C15H20ClFN3O2+ and a molecular weight of 328.80 g/mol. Its IUPAC name is 2-[[1-(3-chloro-4-fluorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]ethyl-dimethylazanium.
| Compound Name | 2-[[1-(3-chloro-4-fluorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 3469819 |
| Molecular Formula | C15H20ClFN3O2+ |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-[[1-(3-chloro-4-fluorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CCNC(=O)C1CC(=O)N(c2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C15H19ClFN3O2/c1-19(2)6-5-18-15(22)10-7-14(21)20(9-10)11-3-4-13(17)12(16)8-11/h3-4,8,10H,5-7,9H2,1-2H3,(H,18,22)/p+1 |
| InChIKey | JPQSTVBJNUOSSC-UHFFFAOYSA-O |
| XLogP | 0.09 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |