C18H25ClFN3O2 — CID 17225427
1-(3-chloro-4-fluorophenyl)-N-[3-(diethylamino)propyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 17225427) has the molecular formula C18H25ClFN3O2 and a molecular weight of 369.87 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-N-[3-(diethylamino)propyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-N-[3-(diethylamino)propyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 17225427 |
| Molecular Formula | C18H25ClFN3O2 |
| Molecular Weight | 369.87 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-N-[3-(diethylamino)propyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)C1CC(=O)N(c2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C18H25ClFN3O2/c1-3-22(4-2)9-5-8-21-18(25)13-10-17(24)23(12-13)14-6-7-16(20)15(19)11-14/h6-7,11,13H,3-5,8-10,12H2,1-2H3,(H,21,25) |
| InChIKey | UNIZIYGRXSPSEQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.87 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|