C20H27ClFN3O2 — CID 5072256
1-(3-chloro-4-fluorophenyl)-N-[3-(4-methylpiperidin-1-yl)propyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 5072256) has the molecular formula C20H27ClFN3O2 and a molecular weight of 395.91 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-N-[3-(4-methylpiperidin-1-yl)propyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-N-[3-(4-methylpiperidin-1-yl)propyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 5072256 |
| Molecular Formula | C20H27ClFN3O2 |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-N-[3-(4-methylpiperidin-1-yl)propyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CC1CCN(CCCNC(=O)C2CC(=O)N(c3ccc(F)c(Cl)c3)C2)CC1 |
| InChI | InChI=1S/C20H27ClFN3O2/c1-14-5-9-24(10-6-14)8-2-7-23-20(27)15-11-19(26)25(13-15)16-3-4-18(22)17(21)12-16/h3-4,12,14-15H,2,5-11,13H2,1H3,(H,23,27) |
| InChIKey | YUKLXOPNGIXELV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|