C17H25ClN3O2+ — CID 9351895
3-[[(3R)-1-(3-chloro-4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]propyl-dimethylazanium (PubChem CID 9351895) has the molecular formula C17H25ClN3O2+ and a molecular weight of 338.86 g/mol. Its IUPAC name is 3-[[(3R)-1-(3-chloro-4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]propyl-dimethylazanium.
| Compound Name | 3-[[(3R)-1-(3-chloro-4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 9351895 |
| Molecular Formula | C17H25ClN3O2+ |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 3-[[(3R)-1-(3-chloro-4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]propyl-dimethylazanium |
| SMILES | Cc1ccc(N2C[C@H](C(=O)NCCC[NH+](C)C)CC2=O)cc1Cl |
| InChI | InChI=1S/C17H24ClN3O2/c1-12-5-6-14(10-15(12)18)21-11-13(9-16(21)22)17(23)19-7-4-8-20(2)3/h5-6,10,13H,4,7-9,11H2,1-3H3,(H,19,23)/p+1/t13-/m1/s1 |
| InChIKey | RRXZFNHJNSPKNG-CYBMUJFWSA-O |
| XLogP | 0.65 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|