C17H26N3O2+ — CID 9350809
dimethyl-[3-[[(3S)-1-(2-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]propyl]azanium (PubChem CID 9350809) has the molecular formula C17H26N3O2+ and a molecular weight of 304.41 g/mol. Its IUPAC name is dimethyl-[3-[[(3S)-1-(2-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]propyl]azanium.
| Compound Name | dimethyl-[3-[[(3S)-1-(2-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 9350809 |
| Molecular Formula | C17H26N3O2+ |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | dimethyl-[3-[[(3S)-1-(2-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]propyl]azanium |
| SMILES | Cc1ccccc1N1C[C@@H](C(=O)NCCC[NH+](C)C)CC1=O |
| InChI | InChI=1S/C17H25N3O2/c1-13-7-4-5-8-15(13)20-12-14(11-16(20)21)17(22)18-9-6-10-19(2)3/h4-5,7-8,14H,6,9-12H2,1-3H3,(H,18,22)/p+1/t14-/m0/s1 |
| InChIKey | SVXOJDYXRWOFIY-AWEZNQCLSA-O |
| XLogP | -0.00 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|