C15H21Cl2N3O2 — CID 119429656
1-(2-chlorophenyl)-N-[3-(methylamino)propyl]-5-oxopyrrolidine-3-carboxamide;hydrochloride (PubChem CID 119429656) has the molecular formula C15H21Cl2N3O2 and a molecular weight of 346.26 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-[3-(methylamino)propyl]-5-oxopyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | 1-(2-chlorophenyl)-N-[3-(methylamino)propyl]-5-oxopyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119429656 |
| Molecular Formula | C15H21Cl2N3O2 |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 1-(2-chlorophenyl)-N-[3-(methylamino)propyl]-5-oxopyrrolidine-3-carboxamide;hydrochloride |
| SMILES | CNCCCNC(=O)C1CC(=O)N(c2ccccc2Cl)C1.Cl |
| InChI | InChI=1S/C15H20ClN3O2.ClH/c1-17-7-4-8-18-15(21)11-9-14(20)19(10-11)13-6-3-2-5-12(13)16;/h2-3,5-6,11,17H,4,7-10H2,1H3,(H,18,21);1H |
| InChIKey | VRMSACXETLOXPK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|