C20H27ClN2O3 — CID 42920333
1-(2-chlorophenyl)-N-(3-cyclohexyloxypropyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 42920333) has the molecular formula C20H27ClN2O3 and a molecular weight of 378.90 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-(3-cyclohexyloxypropyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-N-(3-cyclohexyloxypropyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42920333 |
| Molecular Formula | C20H27ClN2O3 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 1-(2-chlorophenyl)-N-(3-cyclohexyloxypropyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NCCCOC1CCCCC1)C1CC(=O)N(c2ccccc2Cl)C1 |
| InChI | InChI=1S/C20H27ClN2O3/c21-17-9-4-5-10-18(17)23-14-15(13-19(23)24)20(25)22-11-6-12-26-16-7-2-1-3-8-16/h4-5,9-10,15-16H,1-3,6-8,11-14H2,(H,22,25) |
| InChIKey | BFDBUGIHMFQAFP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|