C20H20Cl2N2O2 — CID 124750267
(3R)-1-(2,3-dichlorophenyl)-5-oxo-N-(3-phenylpropyl)pyrrolidine-3-carboxamide (PubChem CID 124750267) has the molecular formula C20H20Cl2N2O2 and a molecular weight of 391.30 g/mol. Its IUPAC name is (3R)-1-(2,3-dichlorophenyl)-5-oxo-N-(3-phenylpropyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(2,3-dichlorophenyl)-5-oxo-N-(3-phenylpropyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 124750267 |
| Molecular Formula | C20H20Cl2N2O2 |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | (3R)-1-(2,3-dichlorophenyl)-5-oxo-N-(3-phenylpropyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)[C@@H]1CC(=O)N(c2cccc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C20H20Cl2N2O2/c21-16-9-4-10-17(19(16)22)24-13-15(12-18(24)25)20(26)23-11-5-8-14-6-2-1-3-7-14/h1-4,6-7,9-10,15H,5,8,11-13H2,(H,23,26)/t15-/m1/s1 |
| InChIKey | XEPTWKSTFKFCMK-OAHLLOKOSA-N |
| XLogP | 4.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|