C16H20Cl2N2O2 — CID 113191264
1-(2,6-dichlorophenyl)-5-oxo-N-pentylpyrrolidine-3-carboxamide (PubChem CID 113191264) has the molecular formula C16H20Cl2N2O2 and a molecular weight of 343.25 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-5-oxo-N-pentylpyrrolidine-3-carboxamide.
| Compound Name | 1-(2,6-dichlorophenyl)-5-oxo-N-pentylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 113191264 |
| Molecular Formula | C16H20Cl2N2O2 |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-5-oxo-N-pentylpyrrolidine-3-carboxamide |
| SMILES | CCCCCNC(=O)C1CC(=O)N(c2c(Cl)cccc2Cl)C1 |
| InChI | InChI=1S/C16H20Cl2N2O2/c1-2-3-4-8-19-16(22)11-9-14(21)20(10-11)15-12(17)6-5-7-13(15)18/h5-7,11H,2-4,8-10H2,1H3,(H,19,22) |
| InChIKey | PNDAPEIYOUOWBI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|