C20H19N3O2 — CID 113191742
1-(2-cyanophenyl)-5-oxo-N-(2-phenylethyl)pyrrolidine-3-carboxamide (PubChem CID 113191742) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is 1-(2-cyanophenyl)-5-oxo-N-(2-phenylethyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(2-cyanophenyl)-5-oxo-N-(2-phenylethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 113191742 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 1-(2-cyanophenyl)-5-oxo-N-(2-phenylethyl)pyrrolidine-3-carboxamide |
| SMILES | N#Cc1ccccc1N1CC(C(=O)NCCc2ccccc2)CC1=O |
| InChI | InChI=1S/C20H19N3O2/c21-13-16-8-4-5-9-18(16)23-14-17(12-19(23)24)20(25)22-11-10-15-6-2-1-3-7-15/h1-9,17H,10-12,14H2,(H,22,25) |
| InChIKey | MPYDWMKSZXLHIJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |