C22H24N2O4 — CID 2552039
(3R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxo-N-(3-phenylpropyl)pyrrolidine-3-carboxamide (PubChem CID 2552039) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is (3R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxo-N-(3-phenylpropyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxo-N-(3-phenylpropyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 2552039 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | (3R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxo-N-(3-phenylpropyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)[C@@H]1CC(=O)N(c2ccc3c(c2)OCCO3)C1 |
| InChI | InChI=1S/C22H24N2O4/c25-21-13-17(22(26)23-10-4-7-16-5-2-1-3-6-16)15-24(21)18-8-9-19-20(14-18)28-12-11-27-19/h1-3,5-6,8-9,14,17H,4,7,10-13,15H2,(H,23,26)/t17-/m1/s1 |
| InChIKey | BQPHPMYXPYHFJY-QGZVFWFLSA-N |
| XLogP | 2.56 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|