C15H18N2O5 — CID 108803813
1-(1,3-benzodioxol-5-yl)-N-(3-hydroxypropyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 108803813) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-(3-hydroxypropyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-(3-hydroxypropyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 108803813 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-(3-hydroxypropyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NCCCO)C1CC(=O)N(c2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C15H18N2O5/c18-5-1-4-16-15(20)10-6-14(19)17(8-10)11-2-3-12-13(7-11)22-9-21-12/h2-3,7,10,18H,1,4-6,8-9H2,(H,16,20) |
| InChIKey | PGXDOCKPEFGJOX-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|