C12H13N3O4 — CID 75366107
1-(1,3-benzodioxol-5-yl)-5-oxopyrrolidine-3-carbohydrazide (PubChem CID 75366107) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-5-oxopyrrolidine-3-carbohydrazide.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-5-oxopyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 75366107 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-5-oxopyrrolidine-3-carbohydrazide |
| SMILES | NNC(=O)C1CC(=O)N(c2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C12H13N3O4/c13-14-12(17)7-3-11(16)15(5-7)8-1-2-9-10(4-8)19-6-18-9/h1-2,4,7H,3,5-6,13H2,(H,14,17) |
| InChIKey | BNCMOJYSYZSPLU-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|