C17H26N3O3+ — CID 9375428
3-[[(3S)-1-(3-methoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]propyl-dimethylazanium (PubChem CID 9375428) has the molecular formula C17H26N3O3+ and a molecular weight of 320.41 g/mol. Its IUPAC name is 3-[[(3S)-1-(3-methoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]propyl-dimethylazanium.
| Compound Name | 3-[[(3S)-1-(3-methoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 9375428 |
| Molecular Formula | C17H26N3O3+ |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 3-[[(3S)-1-(3-methoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]propyl-dimethylazanium |
| SMILES | COc1cccc(N2C[C@@H](C(=O)NCCC[NH+](C)C)CC2=O)c1 |
| InChI | InChI=1S/C17H25N3O3/c1-19(2)9-5-8-18-17(22)13-10-16(21)20(12-13)14-6-4-7-15(11-14)23-3/h4,6-7,11,13H,5,8-10,12H2,1-3H3,(H,18,22)/p+1/t13-/m0/s1 |
| InChIKey | OOLYZLSFZYDXPO-ZDUSSCGKSA-O |
| XLogP | -0.30 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|