C15H17ClN2O4 — CID 9351959
methyl 2-[[(3S)-1-(3-chloro-4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]acetate (PubChem CID 9351959) has the molecular formula C15H17ClN2O4 and a molecular weight of 324.76 g/mol. Its IUPAC name is methyl 2-[[(3S)-1-(3-chloro-4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]acetate.
| Compound Name | methyl 2-[[(3S)-1-(3-chloro-4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 9351959 |
| Molecular Formula | C15H17ClN2O4 |
| Molecular Weight | 324.76 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | methyl 2-[[(3S)-1-(3-chloro-4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)[C@H]1CC(=O)N(c2ccc(C)c(Cl)c2)C1 |
| InChI | InChI=1S/C15H17ClN2O4/c1-9-3-4-11(6-12(9)16)18-8-10(5-13(18)19)15(21)17-7-14(20)22-2/h3-4,6,10H,5,7-8H2,1-2H3,(H,17,21)/t10-/m0/s1 |
| InChIKey | KGZZJYVDOUUPEH-JTQLQIEISA-N |
| XLogP | 1.29 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.76 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |