C12H11Cl2NO2 — CID 94075786
(3S)-1-(3-chloro-4-methylphenyl)-5-oxopyrrolidine-3-carbonyl chloride (PubChem CID 94075786) has the molecular formula C12H11Cl2NO2 and a molecular weight of 272.13 g/mol. Its IUPAC name is (3S)-1-(3-chloro-4-methylphenyl)-5-oxopyrrolidine-3-carbonyl chloride.
| Compound Name | (3S)-1-(3-chloro-4-methylphenyl)-5-oxopyrrolidine-3-carbonyl chloride |
|---|---|
| PubChem CID | 94075786 |
| Molecular Formula | C12H11Cl2NO2 |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | (3S)-1-(3-chloro-4-methylphenyl)-5-oxopyrrolidine-3-carbonyl chloride |
| SMILES | Cc1ccc(N2C[C@@H](C(=O)Cl)CC2=O)cc1Cl |
| InChI | InChI=1S/C12H11Cl2NO2/c1-7-2-3-9(5-10(7)13)15-6-8(12(14)17)4-11(15)16/h2-3,5,8H,4,6H2,1H3/t8-/m0/s1 |
| InChIKey | SHLPKEYXIOGARY-QMMMGPOBSA-N |
| XLogP | 2.77 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|