C18H23ClN2O2 — CID 9351913
(4S)-1-(3-chloro-4-methylphenyl)-4-[(3R)-3-methylpiperidine-1-carbonyl]pyrrolidin-2-one (PubChem CID 9351913) has the molecular formula C18H23ClN2O2 and a molecular weight of 334.85 g/mol. Its IUPAC name is (4S)-1-(3-chloro-4-methylphenyl)-4-[(3R)-3-methylpiperidine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | (4S)-1-(3-chloro-4-methylphenyl)-4-[(3R)-3-methylpiperidine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 9351913 |
| Molecular Formula | C18H23ClN2O2 |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (4S)-1-(3-chloro-4-methylphenyl)-4-[(3R)-3-methylpiperidine-1-carbonyl]pyrrolidin-2-one |
| SMILES | Cc1ccc(N2C[C@@H](C(=O)N3CCC[C@@H](C)C3)CC2=O)cc1Cl |
| InChI | InChI=1S/C18H23ClN2O2/c1-12-4-3-7-20(10-12)18(23)14-8-17(22)21(11-14)15-6-5-13(2)16(19)9-15/h5-6,9,12,14H,3-4,7-8,10-11H2,1-2H3/t12-,14+/m1/s1 |
| InChIKey | BFCINBRSIFABKC-OCCSQVGLSA-N |
| XLogP | 3.26 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |