C18H24N2O2 — CID 6461557
1-(3,4-dimethylphenyl)-4-(piperidine-1-carbonyl)pyrrolidin-2-one (PubChem CID 6461557) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-4-(piperidine-1-carbonyl)pyrrolidin-2-one.
| Compound Name | 1-(3,4-dimethylphenyl)-4-(piperidine-1-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 6461557 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-4-(piperidine-1-carbonyl)pyrrolidin-2-one |
| SMILES | Cc1ccc(N2CC(C(=O)N3CCCCC3)CC2=O)cc1C |
| InChI | InChI=1S/C18H24N2O2/c1-13-6-7-16(10-14(13)2)20-12-15(11-17(20)21)18(22)19-8-4-3-5-9-19/h6-7,10,15H,3-5,8-9,11-12H2,1-2H3 |
| InChIKey | ARCTVSLKOAAPCT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |