C21H29N3O2 — CID 113189848
4-(piperidine-1-carbonyl)-1-(4-piperidin-1-ylphenyl)pyrrolidin-2-one (PubChem CID 113189848) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 4-(piperidine-1-carbonyl)-1-(4-piperidin-1-ylphenyl)pyrrolidin-2-one.
| Compound Name | 4-(piperidine-1-carbonyl)-1-(4-piperidin-1-ylphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 113189848 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 4-(piperidine-1-carbonyl)-1-(4-piperidin-1-ylphenyl)pyrrolidin-2-one |
| SMILES | O=C(C1CC(=O)N(c2ccc(N3CCCCC3)cc2)C1)N1CCCCC1 |
| InChI | InChI=1S/C21H29N3O2/c25-20-15-17(21(26)23-13-5-2-6-14-23)16-24(20)19-9-7-18(8-10-19)22-11-3-1-4-12-22/h7-10,17H,1-6,11-16H2 |
| InChIKey | XSHBZKMDNPBMQW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|